CAS 166981-11-9
:1-[10-hydroxy-11-(octylamino)undecyl]-3,7-dimethyl-3,7-dihydro-1H-purine-2,6-dione
Description:
The chemical substance known as 1-[10-hydroxy-11-(octylamino)undecyl]-3,7-dimethyl-3,7-dihydro-1H-purine-2,6-dione, with the CAS number 166981-11-9, is a purine derivative characterized by its complex structure, which includes a long hydrocarbon chain and multiple functional groups. This compound features a purine core, which is a bicyclic structure composed of fused imidazole and pyrimidine rings, contributing to its biological activity. The presence of the hydroxyl group and the octylamino side chain suggests potential amphiphilic properties, which may influence its solubility and interaction with biological membranes. Additionally, the dimethyl groups on the purine ring can affect its stability and reactivity. Such compounds are often studied for their potential applications in pharmaceuticals, particularly in the context of nucleoside analogs or as modulators of biological pathways. Overall, the unique combination of functional groups and structural features makes this substance of interest in medicinal chemistry and biochemistry.
Formula:C26H47N5O3
InChI:InChI=1/C26H47N5O3/c1-4-5-6-7-12-15-18-27-20-22(32)17-14-11-9-8-10-13-16-19-31-25(33)23-24(28-21-29(23)2)30(3)26(31)34/h21-22,27,32H,4-20H2,1-3H3
Synonyms:- 1H-Purine-2,6-dione, 3,7-dihydro-1-[10-hydroxy-11-(octylamino)undecyl]-3,7-dimethyl-
- 1H-Purine-2,6-dione, 3,7-dihydro-1-(10-hydroxy-11-(octylamino)undecyl)-3,7-dimethyl-
- 1-(11-Octylamino-10-hydroxyundecyl)-3,7-dimethylxanthine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
CT 2576
CAS:CT 2576 is an inhibitor of phospholipid signaling, suppresses constitutive and induced expression of human immunodeficiency virusFormula:C26H47N5O3Color and Shape:SolidMolecular weight:477.68
