CAS 16706-37-9: L-Arginine, N2-benzoyl-, ethyl ester, hydrochloride

Description:L-Arginine, N2-benzoyl-, ethyl ester, hydrochloride is a derivative of the amino acid L-arginine, which is known for its role in protein synthesis and various metabolic processes. This compound features a benzoyl group and an ethyl ester, which enhance its lipophilicity and may influence its biological activity. As a hydrochloride salt, it is typically more soluble in water, facilitating its use in various applications, including pharmaceuticals and biochemistry. The presence of the benzoyl and ethyl ester groups can affect the compound's stability, reactivity, and interaction with biological systems. L-arginine derivatives are often studied for their potential therapeutic effects, including vasodilation and immune modulation. The compound may also serve as a precursor in the synthesis of other bioactive molecules. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Overall, L-Arginine, N2-benzoyl-, ethyl ester, hydrochloride represents a significant compound in the study of amino acids and their derivatives.

Formula:C₁₅H₂₂N₄O₃·xClH

InChI:InChI=1S/C15H22N4O3.ClH/c1-2-22-14(21)12(9-6-10-18-15(16)17)19-13(20)11-7-4-3-5-8-11;/h3-5,7-8,12H,2,6,9-10H2,1H3,(H,19,20)(H4,16,17,18);1H/t12-;/m0./s1

InChI key:InChIKey=HIXDELXKSSLIKB-YDALLXLXSA-N

SMILES:Cl.O=C(OCC)C(NC(=O)C=1C=CC=CC1)CCCNC(=N)N