CAS 167073-08-7

Cyclopropanecarboxylic acid, 2-fluoro-, (1R-trans)-

Description:

Cyclopropanecarboxylic acid, 2-fluoro-, (1R-trans)- is a chemical compound characterized by its cyclopropane ring structure, which is a three-membered carbon ring. The presence of a carboxylic acid functional group (-COOH) indicates that it can act as an acid, capable of donating protons in solution. The "2-fluoro" designation signifies that a fluorine atom is attached to the second carbon of the cyclopropane ring, which can influence the compound's reactivity and polarity. The "(1R-trans)" configuration refers to the specific stereochemistry of the molecule, indicating that the substituents are arranged in a particular spatial orientation, which can affect its biological activity and interactions. This compound is of interest in organic synthesis and medicinal chemistry due to its unique structural features and potential applications in pharmaceuticals. Its properties, such as solubility, boiling point, and reactivity, can be influenced by the presence of the fluorine atom and the carboxylic acid group, making it a subject of study in various chemical contexts.

Formula: C₄H₅FO₂

InChI: InChI=1S/C4H5FO2/c5-3-1-2(3)4(6)7/h2-3H,1H2,(H,6,7)/t2-,3-/m0/s1

InChI key: InChIKey=HZQKMZGKYVDMCT-HRFVKAFMSA-N

SMILES: C(O)(=O)[C@@H]1[C@@H](F)C1

Synonyms:

• (1R,2S)-2-fluorocyclopropanecarboxylic acid
• Cyclopropanecarboxylic acid, 2-fluoro-, (1R,2S)-
• Cyclopropanecarboxylic acid, 2-fluoro-, (1R-trans)-
• Trans-2-Fluorocyclopropanecarboxylic Acid
• (1R,2S)-2-Fluorocyclopropane-1-carboxylic acid

Cyclopropanecarboxylic acid, 2-fluoro-, (1R-trans)- (9CI)

CAS: 167073-08-7

Formula: C₄H₅FO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 104.0797

Ref: IN-DA001X3X

(1R,2S)-2-Fluorocyclopropanecarboxylic acid

CAS: 167073-08-7

(1R,2S)-2-Fluorocyclopropanecarboxylic acid

Purity: 97%

Color and Shape: Liquid

Molecular weight: 104.08g/mol

Ref: 54-PC400539

(1R,2S)-2-Fluorocyclopropane-1-carboxylic acid

CAS: 167073-08-7

Purity: 97%

Color and Shape: Solid

Molecular weight: 104.0800018

Ref: 10-F614257

(1R,2S)-2-Fluorocyclopropanecarboxylic acid

CAS: 167073-08-7

(1R,2S)-2-Fluorocyclopropanecarboxylic acid is an organic compound that belongs to the group of carboxylic acids. It is a chiral molecule because it has two different forms, which are enantiomers. (1R,2S)-2-Fluorocyclopropanecarboxylic acid is a colorless liquid with a boiling point of 107°C and a melting point of -57.6°C. The chemical formula for this compound is C3H3FO2. (1R,2S)-2-Fluorocyclopropanecarboxylic acid can be used as an intermediate for other organic synthesis reactions or as a building block for the production of pharmaceuticals such as fluoroquinolones and prostaglandins.

Purity: Min. 95%

Ref: 3D-SGA07308