CAS 167095-09-2
:Chloromethyl-X-rosamine
Description:
Chloromethyl-X-rosamine, identified by its CAS number 167095-09-2, is a synthetic chemical compound that belongs to the class of rosamines, which are characterized by their unique structural features and biological activity. This compound typically exhibits a chloromethyl group, which can enhance its reactivity and potential for further chemical modifications. Chloromethyl-X-rosamine is often studied for its applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its potential biological activity. The presence of the chloromethyl group may also influence its solubility and stability in various solvents. Additionally, compounds in this class may exhibit properties such as fluorescence, making them useful in biological imaging and as probes in biochemical assays. However, specific safety and handling guidelines should be followed, as many chlorinated compounds can pose health risks. As with any chemical substance, understanding its reactivity, stability, and potential applications is crucial for its effective use in research and industry.
Formula:C32H32ClN2O·Cl
InChI:InChI=1S/C32H32ClN2O.ClH/c33-19-20-9-11-21(12-10-20)28-26-17-22-5-1-13-34-15-3-7-24(29(22)34)31(26)36-32-25-8-4-16-35-14-2-6-23(30(25)35)18-27(28)32;/h9-12,17-18H,1-8,13-16,19H2;1H/q+1;/p-1
InChI key:InChIKey=IKEOZQLIVHGQLJ-UHFFFAOYSA-M
SMILES:C(Cl)C1=CC=C(C=2C=3C(=C4C5=C(C3)CCCN5CCC4)[O+]=C6C2C=C7C8=C6CCCN8CCC7)C=C1.[Cl-]
Synonyms:- Chloromethyl-X-rosamine
- 1H,5H,11H,15H-Xantheno[2,3,4-ij:5,6,7-i'j′]diquinolizin-18-ium, 9-[4-(chloromethyl)phenyl]-2,3,6,7,12,13,16,17-octahydro-, chloride
- 1H,5H,11H,15H-Xantheno[2,3,4-ij:5,6,7-i'j′]diquinolizin-18-ium, 9-[4-(chloromethyl)phenyl]-2,3,6,7,12,13,16,17-octahydro-, chloride (1:1)
- MitoTracker CMXRos
- CMXRos
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
MitoMark Red I
CAS:MitoMark Red I is a far red fluorescent mitochondrial stain (λmax ~ 594/608 nm).Formula:C32H32Cl2N2OColor and Shape:SolidMolecular weight:531.52
