CAS 167095-10-5
:5-Aminotetramethylrhodamine
Description:
5-Aminotetramethylrhodamine, with the CAS number 167095-10-5, is a fluorescent dye commonly used in biological and chemical research. It belongs to the rhodamine family, characterized by its vibrant fluorescence, which is attributed to its xanthene structure. This compound features an amino group that enhances its solubility in aqueous solutions, making it suitable for various applications, including labeling and imaging in microscopy. The dye exhibits strong absorbance and emission properties, typically in the green to red spectrum, allowing for effective visualization in fluorescence microscopy and flow cytometry. Additionally, 5-Aminotetramethylrhodamine is often utilized in the development of biosensors and as a tracer in biological systems due to its stability and low toxicity. Its ability to bind to specific biomolecules enables researchers to track cellular processes and interactions. Overall, this compound is valued for its versatility and effectiveness in scientific research, particularly in the fields of biochemistry and molecular biology.
Formula:C24H23N3O3
InChI:InChI=1/C24H23N3O3/c1-26(2)15-6-9-19-21(12-15)29-22-13-16(27(3)4)7-10-20(22)24(19)18-8-5-14(25)11-17(18)23(28)30-24/h5-13H,25H2,1-4H3
SMILES:CN(C)c1ccc2c(c1)Oc1cc(ccc1C12c2ccc(cc2C(=O)O1)N)N(C)C
Synonyms:- 5-amino-3',6'-bis(dimethylamino)-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 5-amino-3',6'-bis(dimethylamino)-
CAS:Formula:C24H23N3O3Molecular weight:401.45775-Aminotetramethyl rhodamine
CAS:5-Aminotetramethyl rhodamine is a chemical that is used as a reagent, intermediate, and building block in the synthesis of organic compounds. This compound is useful as an intermediate in the synthesis of complex compounds, such as pharmaceuticals, agrochemicals, and other fine chemicals. 5-Aminotetramethyl rhodamine can also be used as a speciality chemical or research chemical. It has been shown to be a versatile building block in the synthesis of new compounds with potential use in applications such as medicine and electronics.
Formula:C24H23N3O3Purity:Min. 95%Color and Shape:PowderMolecular weight:401.46 g/mol5-Aminotetramethyl Rhodamine
CAS:Controlled ProductApplications Synthetic Intermediate
Formula:C24H23N3O3Color and Shape:NeatMolecular weight:401.46



