CAS 1671-87-0: 3,6-Bis(2-pyridyl)-1,2,4,5-tetrazine
Description:3,6-Bis(2-pyridyl)-1,2,4,5-tetrazine is a heterocyclic compound characterized by its tetrazine core, which consists of a five-membered ring containing four nitrogen atoms and one carbon atom. This compound features two 2-pyridyl substituents at the 3 and 6 positions of the tetrazine ring, contributing to its aromatic properties and potential for coordination chemistry. The presence of nitrogen atoms in the structure imparts notable stability and reactivity, making it of interest in various applications, including materials science and coordination complexes. The compound is typically synthesized through cyclization reactions involving appropriate precursors. Its unique electronic properties, influenced by the pyridyl groups, allow for potential applications in organic electronics and as a ligand in metal coordination chemistry. Additionally, the compound may exhibit interesting photophysical properties, making it a candidate for studies in fluorescence and photochemistry. Overall, 3,6-Bis(2-pyridyl)-1,2,4,5-tetrazine is a versatile compound with significant implications in both theoretical and applied chemistry.
Formula:C12H8N6
InChI:InChI=1S/C12H8N6/c1-3-7-13-9(5-1)11-15-17-12(18-16-11)10-6-2-4-8-14-10/h1-8H
InChI key:InChIKey=JFBIRMIEJBPDTQ-UHFFFAOYSA-N
SMILES:N1=NC(=NN=C1C=2N=CC=CC2)C3=NC=CC=C3
- Synonyms:
- 1,2,4,5-Tetrazine, 3,6-di-2-pyridinyl-
- 3,6-(2-Pyridinyl)-1,2,4,5-tetrazine
- 3,6-Bi-2-pyridyl-1,2,4,5-tetrazine
- 3,6-Bis(2-pyridinyl)-1,2,4,5-tetrazine
- 3,6-Bis(2-pyridyl)-1,2,4,5-tetrazine
- 3,6-Bis(2-pyridyl)-s-tetrazine
- 3,6-Bis(2-pyridyl)tetrazine
- 3,6-Di(Pyridin-2-Yl)-1,2,4,5-Tetrazine
- 3,6-Di-2-pyridinyl-1,2,4,5-tetrazine
- 3,6-Di-2-pyridyl-s-tetrazine
- See more synonyms
- 3,6-Diphenyl-1,2,4,5-Tetrazine
- Bptz
- NSC 238155
- s-Tetrazine, 3,6-di-2-pyridyl-
- s-Tetrazine, di-2-pyridyl-
- 3,6-di-2-pyridyl-1,2,4,5-tetrazine