CAS 167155-53-5

5-(Methoxymethyl)-3-isoxazolemethanol

Description:

5-(Methoxymethyl)-3-isoxazolemethanol is a chemical compound characterized by its unique isoxazole ring structure, which contributes to its potential biological activity. This compound features a methoxymethyl group, enhancing its solubility and reactivity. The presence of the hydroxymethyl group indicates that it can participate in hydrogen bonding, which may influence its interactions with biological targets. Typically, compounds like this are studied for their pharmacological properties, including potential antimicrobial or anti-inflammatory effects. The molecular structure suggests that it may exhibit polar characteristics, making it suitable for various applications in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many organic compounds, safety and handling precautions are essential, particularly in laboratory settings. Overall, 5-(Methoxymethyl)-3-isoxazolemethanol represents a class of compounds that may hold promise in drug development and other chemical applications.

Formula: C₆H₉NO₃

InChI: InChI=1S/C6H9NO3/c1-9-4-6-2-5(3-8)7-10-6/h2,8H,3-4H2,1H3

InChI key: InChIKey=CTVKFHLSTYWQLY-UHFFFAOYSA-N

SMILES: C(OC)C1=CC(CO)=NO1

Synonyms:

• 3-(Hydroxymethyl)-5-(methoxymethyl)isoxazole
• 5-(Methoxymethyl)-3-isoxazolemethanol
• 3-Isoxazolemethanol, 5-(methoxymethyl)-

[5-(methoxymethyl)-1,2-oxazol-3-yl]methanol

CAS: 167155-53-5

Purity: 98%

Molecular weight: 143.1419983

Ref: 10-F655183

[5-(Methoxymethyl)-1,2-oxazol-3-yl]methanol

CAS: 167155-53-5

Versatile small molecule scaffold

Formula: C₆H₉NO₃

Purity: Min. 95%

Molecular weight: 143.1 g/mol

Ref: 3D-SGA15553