CAS 16718-11-9
:3-(Phenylthio)thiophene
Description:
3-(Phenylthio)thiophene is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. The presence of a phenylthio group at the 3-position of the thiophene ring introduces both electronic and steric effects, influencing its reactivity and properties. This compound typically exhibits a yellow to brown color and is soluble in organic solvents, making it useful in various chemical applications. Its structure allows for potential applications in organic electronics, such as in organic semiconductors and photovoltaic devices, due to its ability to facilitate charge transport. Additionally, the compound may exhibit interesting photophysical properties, including fluorescence, which can be exploited in sensor technologies. The presence of sulfur atoms in both the thiophene and phenylthio groups can also contribute to its chemical reactivity, making it a candidate for further functionalization in synthetic chemistry. Overall, 3-(Phenylthio)thiophene is a versatile compound with potential applications in materials science and organic synthesis.
Formula:C10H8S2
InChI:InChI=1/C10H8S2/c1-2-4-9(5-3-1)12-10-6-7-11-8-10/h1-8H
SMILES:c1ccc(cc1)Sc1ccsc1
Synonyms:- Phenyl 3-thienyl sulphide
- 3-(Phenylsulfanyl)Thiophene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-(Phenylthio)thiophene, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C10H8S2Purity:97%Color and Shape:Clear colorless, LiquidMolecular weight:192.29


