CAS 16718-95-9
:methyl 4,6-O-benzylidene-2-deoxyhexopyranoside
Description:
Methyl 4,6-O-benzylidene-2-deoxyhexopyranoside is a chemical compound that belongs to the class of glycosides, specifically a derivative of a deoxyhexose sugar. It features a methyl group, a benzylidene moiety, and a pyranose ring structure, which contributes to its unique properties. This compound is typically characterized by its white to off-white crystalline appearance and is soluble in organic solvents such as methanol and ethanol, but less soluble in water due to its hydrophobic benzylidene group. The presence of the benzylidene group enhances its stability and can influence its reactivity, making it useful in various organic synthesis applications. Additionally, it may exhibit biological activity, which can be of interest in medicinal chemistry. Its molecular structure allows for potential interactions with biological macromolecules, making it a candidate for further research in drug development or as a biochemical probe. As with many organic compounds, handling should be done with care, following appropriate safety protocols.
Formula:C14H18O5
InChI:InChI=1/C14H18O5/c1-16-12-7-10(15)13-11(18-12)8-17-14(19-13)9-5-3-2-4-6-9/h2-6,10-15H,7-8H2,1H3
SMILES:COC1CC(C2C(COC(c3ccccc3)O2)O1)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.