CAS 167221-71-8: Methyl (1-oxobutoxy)methyl 4-(2,3-dichlorophenyl)-1,4-dihydro-2,6-dime thyl-3,5-pyridinedicarboxylate
Description:Methyl (1-oxobutoxy)methyl 4-(2,3-dichlorophenyl)-1,4-dihydro-2,6-dimethyl-3,5-pyridinedicarboxylate, with the CAS number 167221-71-8, is a chemical compound that belongs to the class of pyridine derivatives. This substance features a complex molecular structure characterized by multiple functional groups, including ester and ketone functionalities, which contribute to its reactivity and potential applications in organic synthesis. The presence of dichlorophenyl groups indicates that it may exhibit unique electronic properties and biological activity, making it of interest in medicinal chemistry. Additionally, the dihydropyridine framework suggests potential applications in the development of pharmaceuticals, particularly in the context of calcium channel blockers or other therapeutic agents. Its solubility, stability, and reactivity can vary based on the specific conditions and solvents used. As with many organic compounds, safety data and handling precautions should be considered, especially regarding its potential toxicity and environmental impact. Further studies would be necessary to fully elucidate its properties and applications.
Formula:C21H23Cl2NO6
InChI:InChI=1S/C21H23Cl2NO6/c1-5-7-15(25)29-10-30-21(27)17-12(3)24-11(2)16(20(26)28-4)18(17)13-8-6-9-14(22)19(13)23/h6,8-9,18,24H,5,7,10H2,1-4H3
InChI key:InChIKey=KPBZROQVTHLCDU-UHFFFAOYSA-N
SMILES:O=C(OC)C1=C(NC(=C(C(=O)OCOC(=O)CCC)C1C=2C=CC=C(Cl)C2Cl)C)C
- Synonyms:
- 3,5-Pyridinedicarboxylic acid, 4-(2,3-dichlorophenyl)-1,4-dihydro-2,6-dimethyl-, 3-methyl 5-[(1-oxobutoxy)methyl] ester
- 3,5-Pyridinedicarboxylic acid, 4-(2,3-dichlorophenyl)-1,4-dihydro-2,6-dimethyl-, methyl (1-oxobutoxy)methyl ester
- 4-(2,3-dichlorophenyl)-1,4-dihydro-2,6-dimethyl-3,5-Pyridinedicarboxylic acid methyl (1-oxobutoxy)methyl ester
- Clevelox
- Clevidipine
- Clevidipine butyrate
- Cleviprex
- H 324/38
- rac-Clevidipine
