CAS 16724-03-1
:2,3-Dihydro-2-selenoxo-4(1H)-pyrimidinone
Description:
2,3-Dihydro-2-selenoxo-4(1H)-pyrimidinone, with the CAS number 16724-03-1, is a heterocyclic organic compound featuring a pyrimidinone ring that incorporates selenium in its structure. This compound is characterized by the presence of a selenoxo group, which contributes to its unique chemical properties and reactivity. Typically, compounds containing selenium exhibit interesting biological activities and can serve as potential pharmacophores in medicinal chemistry. The presence of the dihydro group indicates that the compound may exist in a reduced form, which can influence its stability and reactivity. Additionally, the pyrimidinone structure suggests potential applications in nucleic acid chemistry and as a building block for various organic syntheses. The compound's solubility, melting point, and specific reactivity would depend on its molecular interactions and the presence of functional groups. Overall, 2,3-Dihydro-2-selenoxo-4(1H)-pyrimidinone represents a class of compounds that may have significant implications in both synthetic and medicinal chemistry.
Formula:C4H4N2OSe
InChI:InChI=1S/C4H4N2OSe/c7-3-1-2-5-4(8)6-3/h1-2H,(H2,5,6,7,8)
InChI key:InChIKey=NGXVPIDNNNKQIL-UHFFFAOYSA-N
SMILES:O=C1NC(=[Se])NC=C1
Synonyms:- (6-Oxo-1,6-Dihydropyrimidin-2-Yl)Selanyl
- 2,3-Dihydro-2-selenoxo-4(1H)-pyrimidinone
- 2-Selenouracil
- 4(1H)-Pyrimidinone, 2,3-dihydro-2-selenoxo-
- NSC 14583
- Uracil, 2-seleno-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Selenouracil
CAS:<p>2-Selenouracil is a specialized photosensitizer for photodynamical therapy.</p>Formula:C4H4N2OSeColor and Shape:SolidMolecular weight:175.05
