CAS 16726-67-3

5-bromonaphthalene-1-carboxylic acid

Description:

5-Bromonaphthalene-1-carboxylic acid is an aromatic compound characterized by the presence of a bromine atom and a carboxylic acid functional group attached to a naphthalene ring system. This compound features a naphthalene backbone, which consists of two fused benzene rings, providing it with significant stability and hydrophobic characteristics. The bromine substituent introduces both electronegativity and steric effects, influencing the compound's reactivity and solubility. The carboxylic acid group (-COOH) imparts acidic properties, allowing for potential hydrogen bonding and increased solubility in polar solvents. This compound is typically used in organic synthesis, serving as an intermediate in the production of various pharmaceuticals, agrochemicals, and dyes. Its reactivity can be attributed to the electrophilic nature of the aromatic system, making it suitable for further functionalization. Additionally, the presence of the bromine atom can facilitate cross-coupling reactions, enhancing its utility in synthetic organic chemistry. Overall, 5-bromonaphthalene-1-carboxylic acid is a versatile compound with applications in various chemical fields.

Formula: C₁₁H₇BrO₂

InChI: InChI=1/C11H7BrO2/c12-10-6-2-3-7-8(10)4-1-5-9(7)11(13)14/h1-6H,(H,13,14)

SMILES: c1cc2c(cccc2Br)c(c1)C(=O)O

Synonyms:

• 5-Bromo-1-naphthoic acid
• 5-bromonaphthalene-1-carboxylic acid
• 5-Bromo-phthalene-1-carboxylic acid
• 5-bromo-1-naphthalenecarboxylic acid
• 1-Naphthalenecarboxylic acid, 5-bromo-

5-Bromo-1-naphthoic acid

CAS: 16726-67-3

Formula: C₁₁H₇BrO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 251.0761

Ref: IN-DA007W60

5-Bromo-1-naphthoic acid

CAS: 16726-67-3

5-Bromo-1-naphthoic acid

Purity: 97%

Molecular weight: 251.08g/mol

Ref: 54-OR74982

5-Bromo-1-naphthoic acid

CAS: 16726-67-3

Formula: C₁₁H₇BrO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 251.079

Ref: 10-F214702