CAS 1672655-82-1

2-Pyridineacetic acid, α-bromo-3-chloro-5-(trifluoromethyl)-, methyl ester

Description:

2-Pyridineacetic acid, α-bromo-3-chloro-5-(trifluoromethyl)-, methyl ester, identified by CAS number 1672655-82-1, is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a methyl ester functional group, indicating that it is an ester formed from the reaction of pyridineacetic acid with methanol. The presence of bromine and chlorine substituents, along with a trifluoromethyl group, suggests that it may exhibit unique reactivity and properties, such as increased lipophilicity and potential biological activity. The trifluoromethyl group is known to enhance the metabolic stability of compounds, making them more resistant to degradation. Additionally, the halogen substituents can influence the compound's polarity and solubility in various solvents. Overall, this compound may be of interest in medicinal chemistry and agrochemical applications due to its structural features and potential biological effects.

Formula: C₉H₆BrClF₃NO₂

InChI: InChI=1S/C9H6BrClF3NO2/c1-17-8(16)6(10)7-5(11)2-4(3-15-7)9(12,13)14/h2-3,6H,1H3

InChI key: InChIKey=ZRZGEXBOQBOEGL-UHFFFAOYSA-N

SMILES: C(C(OC)=O)(Br)C1=C(Cl)C=C(C(F)(F)F)C=N1

Synonyms:

• Methyl α-bromo-3-chloro-5-(trifluoromethyl)-2-pyridineacetate
• 2-Pyridineacetic acid, α-bromo-3-chloro-5-(trifluoromethyl)-, methyl ester

Methyl 2-bromo-2-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]acetate

CAS: 1672655-82-1

Methyl 2-bromo-2-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]acetate

Purity: 95%

Molecular weight: 332.50g/mol

Ref: 54-PC401031