CAS 16727-44-9

3,5-Dibromo-2,6-dimethoxypyridine, 99%

Description:

3,5-Dibromo-2,6-dimethoxypyridine is a heterocyclic organic compound characterized by its pyridine ring, which is substituted at the 2 and 6 positions with methoxy groups and at the 3 and 5 positions with bromine atoms. This compound typically appears as a solid and is known for its potential applications in pharmaceuticals and agrochemicals due to its unique structural features. The presence of bromine atoms enhances its reactivity, making it useful in various chemical reactions, including cross-coupling reactions and as a building block in organic synthesis. The methoxy groups contribute to its solubility and influence its electronic properties, which can affect its biological activity. As a chemical with a purity of 99%, it is suitable for research and development purposes, ensuring minimal impurities that could interfere with experimental results. Safety precautions should be observed when handling this compound, as brominated compounds can pose health risks, and proper storage conditions are necessary to maintain its stability.

Formula: C₇H₇Br₂NO₂

InChI: InChI=1/C7H7Br2NO2/c1-11-6-4(8)3-5(9)7(10-6)12-2/h3H,1-2H3

SMILES: COc1c(cc(c(n1)OC)Br)Br

Synonyms:

• 3,5-Dibromo-2,6-Dimethoxy-Pyridine

3,5-Dibromo-2,6-dimethoxypyridine

CAS: 16727-44-9

Formula: C₇H₇Br₂NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 296.9440

Ref: IN-DA003IKU

3,5-Dibromo-2,6-dimethoxypyridine

CAS: 16727-44-9

3,5-Dibromo-2,6-dimethoxypyridine

Formula: C₇H₇Br₂NO₂

Purity: 99%

Color and Shape: white to light yellow solid

Molecular weight: 296.94397g/mol

Ref: 54-OR302296

3,5-Dibromo-2,6-dimethoxypyridine

CAS: 16727-44-9

Formula: C₇H₇Br₂NO₂

Purity: 98%

Molecular weight: 296.946

Ref: 10-F462405