CAS 1673-44-5

5-(3-methoxyphenyl)-1,3,4-oxadiazol-2-amine

Description:

5-(3-Methoxyphenyl)-1,3,4-oxadiazol-2-amine, with the CAS number 1673-44-5, is a chemical compound characterized by its oxadiazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms and three carbon atoms. This compound features a methoxyphenyl group, indicating the presence of a methoxy (-OCH₃) substituent on a phenyl ring, which can influence its solubility and reactivity. The oxadiazole moiety is known for its potential biological activity, including antimicrobial and anti-inflammatory properties. The amine functional group (-NH₂) contributes to its reactivity, allowing for various chemical modifications. This compound may exhibit interesting electronic properties due to the conjugation between the aromatic system and the heterocyclic ring. Its applications could span across pharmaceuticals, agrochemicals, and materials science, depending on its specific interactions and properties. As with many organic compounds, safety data and handling precautions should be considered when working with this substance.

Formula: C₉H₉N₃O₂

InChI: InChI=1/C9H9N3O2/c1-13-7-4-2-3-6(5-7)8-11-12-9(10)14-8/h2-5H,1H3,(H2,10,12)

SMILES: COc1cccc(c1)c1n[nH]c(=N)o1

Synonyms:

• 1,3,4-Oxadiazol-2-Amine, 5-(3-Methoxyphenyl)-

5-(3-Methoxyphenyl)-1,3,4-oxadiazol-2-amine

CAS: 1673-44-5

Formula: C₉H₉N₃O₂

Color and Shape: Solid

Molecular weight: 191.1867

Ref: IN-DA001XAD

2-Amino-5-(3-methoxyphenyl)-1,3,4-oxadiazole

CAS: 1673-44-5

2-Amino-5-(3-methoxyphenyl)-1,3,4-oxadiazole

Purity: ≥95%

Molecular weight: 191.19g/mol

Ref: 54-OR51747

5-(3-methoxyphenyl)-1,3,4-oxadiazol-2-amine

CAS: 1673-44-5

Formula: C₉H₉N₃O₂

Purity: 95.0%

Molecular weight: 191.19

Ref: 10-F311673