CAS 1673-47-8
:3-Chlorobenzohydrazide
Description:
3-Chlorobenzohydrazide is an organic compound characterized by the presence of a hydrazide functional group attached to a chlorinated benzene ring. Its molecular structure features a chlorine atom positioned at the meta position relative to the hydrazide group, which influences its reactivity and physical properties. This compound typically appears as a white to off-white crystalline solid and is soluble in organic solvents, with limited solubility in water. 3-Chlorobenzohydrazide is known for its applications in various fields, including pharmaceuticals and agrochemicals, often serving as an intermediate in the synthesis of more complex molecules. The presence of the hydrazide group allows for potential reactivity in condensation reactions, making it useful in the formation of hydrazones and other derivatives. Additionally, the chlorine substituent can enhance the compound's biological activity and influence its interaction with other chemical species. As with many hydrazides, it may exhibit biological properties, including antimicrobial or antitumor activities, warranting further investigation in medicinal chemistry.
Formula:C7H7ClN2O
InChI:InChI=1S/C7H7ClN2O/c8-6-3-1-2-5(4-6)7(11)10-9/h1-4H,9H2,(H,10,11)
InChI key:InChIKey=PHRDZSRVSVNQRN-UHFFFAOYSA-N
SMILES:C(NN)(=O)C1=CC(Cl)=CC=C1
Synonyms:- (3-Chlorobenzoyl)hydrazine
- (m-Chlorobenzoyl)hydrazine
- 3-Chlorobenzene-1-Carbohydrazide
- 3-Chlorobenzenecarboxylic acid hydrazide
- 3-Chlorobenzhydrazide, (3-Chlorobenzoic acid hydrazide)
- 3-Chlorobenzohydrazide
- 3-Chlorobenzohydroazide
- 3-Chlorobenzoic Acid Hydrazide
- 3-Chlorobenzoic Hydrazide
- 3-Chlorobenzoyl hydrazide
- Akos Bbs-00004508
- Asischem D51116
- Benzoic acid, 3-chloro-, hydrazide
- Benzoic acid, m-chloro-, hydrazide
- Specs An-068/40169986
- m-Chlorobenzoic acid hydrazide
- m-Chlorobenzoic hydrazide
- m-Chlorobenzoyl hydrazide
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Benzoic acid, 3-chloro-, hydrazide
CAS:Formula:C7H7ClN2OPurity:98%Color and Shape:SolidMolecular weight:170.59633-Chlorobenzoic hydrazide, min. 98%
CAS:Formula:C7H7ClN2OPurity:min. 98%Color and Shape:White to off-white solidMolecular weight:170.63-Chlorobenzohydrazide
CAS:Formula:C7H7ClN2OPurity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:170.603-Chlorobenzhydrazide
CAS:3-ChlorobenzhydrazidePurity:≥95%Color and Shape:PowderMolecular weight:170.60g/mol3-Chlorobenzhydrazide
CAS:3-Chlorobenzhydrazide is a dihedral molecule that can be classified as an antibacterial and antimycobacterial agent. It has the capability to inhibit bacterial growth by binding to the active site of their ribosomal 50S subunit, thereby inhibiting protein synthesis. 3-Chlorobenzhydrazide also inhibits sodium channels in myocytes, which may lead to heart problems. 3-Chlorobenzhydrazide is also known for its inotropic effects on the heart muscle and its ability to stimulate hormones such as adrenaline and noradrenaline. The crystal x-ray diffraction study revealed that 3-chlorobenzhydrazide forms a hydrogen bond with hydroxyl groups of amino acids in proteins. This property makes it an effective antibacterial agent against Gram-positive bacteria such as staphylococci and Mycobacteria tuberculosis.Formula:C7H7ClN2OPurity:Min. 95%Color and Shape:PowderMolecular weight:170.6 g/mol






