CAS 16732-64-2

4-Bromo-2-indolecarboxylic acid

Description:

4-Bromo-2-indolecarboxylic acid is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a bromine atom at the 4-position and a carboxylic acid functional group at the 2-position contributes to its unique chemical properties. This compound typically appears as a solid and is soluble in polar solvents, reflecting its polar carboxylic acid group. It is often used in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals due to its potential biological activity. The bromine substituent can enhance the compound's reactivity, making it useful in various chemical reactions, including electrophilic substitutions. Additionally, 4-bromo-2-indolecarboxylic acid may exhibit interesting biological properties, which can be explored in research contexts. As with many chemical substances, proper handling and safety precautions are essential due to potential hazards associated with brominated compounds.

Formula: C₉H₆BrNO₂

InChI: InChI=1/C9H6BrNO2/c10-6-2-1-3-7-5(6)4-8(11-7)9(12)13/h1-4,11H,(H,12,13)

SMILES: c1cc(c2cc(C(=O)O)[nH]c2c1)Br

Synonyms:

• 4-Bromo-1H-Indole-2-Carboxylic Acid

1H-Indole-2-carboxylic acid, 4-bromo-

CAS: 16732-64-2

Formula: C₉H₆BrNO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 240.0534

Ref: IN-DA001XAV

4-Bromo-1H-indole-2-carboxylic acid

CAS: 16732-64-2

4-Bromo-1H-indole-2-carboxylic acid

Purity: 97%

Molecular weight: 240.056g/mol

Ref: 54-OR75184

4-Bromo-1H-indole-2-carboxylic acid

CAS: 16732-64-2

Formula: C₉H₆BrNO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 240.056

Ref: 10-F079941