CAS 16732-69-7

Ethyl 7-bromo-1H-indole-2-carboxylate

Description:

Ethyl 7-bromo-1H-indole-2-carboxylate is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a bromine atom at the 7-position of the indole ring introduces a halogen substituent, which can influence the compound's reactivity and biological activity. The ethyl ester functional group at the 2-position contributes to its solubility and potential applications in organic synthesis. This compound is often utilized in medicinal chemistry and research due to its structural features that may exhibit pharmacological properties. Its CAS number, 16732-69-7, serves as a unique identifier for regulatory and safety information. Ethyl 7-bromo-1H-indole-2-carboxylate may also participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it a valuable intermediate in the synthesis of more complex molecules. As with many brominated compounds, it is essential to handle it with care due to potential toxicity and environmental considerations.

Formula: C₁₁H₁₀BrNO₂

InChI: InChI=1/C11H10BrNO2/c1-2-15-11(14)9-6-7-4-3-5-8(12)10(7)13-9/h3-6,13H,2H2,1H3

SMILES: CCOC(=O)c1cc2cccc(c2[nH]1)Br

Synonyms:

• 7-Bromoindole-2-Carboxylic Acid Ethyl Ester
• 7-Bromo-1H-Indole-2-Carboxylic Acid Ethyl Ester
• Ethyl 7-Bromoindole-2-Carboxylate

1H-Indole-2-carboxylic acid, 7-bromo-, ethyl ester

CAS: 16732-69-7

Formula: C₁₁H₁₀BrNO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 268.1066

Ref: IN-DA001XAS

Ethyl 7-bromo-1H-indole-2-carboxylate

CAS: 16732-69-7

Ethyl 7-bromo-1H-indole-2-carboxylate

Formula: C₁₁H₁₀BrNO₂

Purity: 93%

Color and Shape: white to light yellow solid

Molecular weight: 268.11g/mol

Ref: 54-OR480619

Ethyl 7-bromoindole-2-carboxylate

CAS: 16732-69-7

Formula: C₁₁H₁₀BrNO₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 268.11

Ref: 10-F076347