CAS 16732-75-5

6-Chloro-1H-indole-2-carboxylic acid

Description:

6-Chloro-1H-indole-2-carboxylic acid is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a chlorine atom at the 6-position and a carboxylic acid group at the 2-position contributes to its unique chemical properties. This compound is typically a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the carboxylic acid functionality. It exhibits acidic behavior, allowing it to participate in various chemical reactions, including esterification and amidation. The chlorine substituent can influence its reactivity and biological activity, making it of interest in medicinal chemistry and drug development. Additionally, 6-Chloro-1H-indole-2-carboxylic acid may serve as a building block in the synthesis of more complex molecules, particularly in the development of pharmaceuticals. Its specific applications and biological activities can vary, necessitating further research to fully understand its potential uses in various fields.

Formula: C₉H₆ClNO₂

InChI: InChI=1S/C9H6ClNO2/c10-6-2-1-5-3-8(9(12)13)11-7(5)4-6/h1-4,11H,(H,12,13)

InChI key: InChIKey=BKPSJOSKWKTWAG-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC=2C(N1)=CC(Cl)=CC2

Synonyms:

• 1H-Indole-2-Carboxylic Acid, 6-Chloro-
• 2-Carboxy-6-chloroindole
• 6-Chloro-1H-Indole-2-Carboxylic Acid
• 6-Chloro-2-Indolecarboxylic Acid
• Akos Jy2083447
• Indole-2-carboxylic acid, 6-chloro-
• 6-Chloroindole-2-carboxylic acid

1H-Indole-2-carboxylic acid, 6-chloro-

CAS: 16732-75-5

Formula: C₉H₆ClNO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 195.6024

Ref: IN-DA001XBR

6-Chloroindole-2-carboxylic acid

CAS: 16732-75-5

Ref: 7W-GK3272

6-Chloroindole-2-carboxylic acid

CAS: 16732-75-5

6-Chloroindole-2-carboxylic acid

Purity: 98%

Molecular weight: 195.60g/mol

Ref: 54-OR911762

6-Chloroindole-2-carboxylic acid

CAS: 16732-75-5

Formula: C₉H₆ClNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 195.6

Ref: 10-F092378

6-Chloroindole-2-carboxylic acid

CAS: 16732-75-5

6-Chloroindole-2-carboxylicacid is a potent inhibitor of β-lactamase enzymes. It has been shown to act as a competitive inhibitor with an affinity for the β-lactamase enzyme in the nanomolar range. 6-Chloroindole-2-carboxylicacid is also a potent compound that can be used in experiments and screening. It has been shown to bind to the β-lactamase enzyme, which inhibits its activity, leading to a decrease in fluorescence. 6-Chloroindole-2-carboxylicacid has also been shown to have an inhibitory effect on bacterial cells by inhibiting protein synthesis, DNA replication, and RNA transcription.

Formula: C₉H₆ClNO₂

Purity: 95%Nmr

Molecular weight: 195.6 g/mol

Ref: 3D-FC147356