CymitQuimica logo

CAS 16735-76-5

:

4-(4-Methoxybenzyl)-3-thiosemicarbazide

Description:
4-(4-Methoxybenzyl)-3-thiosemicarbazide is a chemical compound characterized by its thiosemicarbazide functional group, which is known for its diverse biological activities. This compound features a methoxybenzyl substituent, contributing to its lipophilicity and potential interactions with biological targets. It typically appears as a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of sulfur in the thiosemicarbazide moiety can enhance its reactivity and ability to form coordination complexes with metal ions. This compound has garnered interest in medicinal chemistry due to its potential pharmacological properties, including antimicrobial and anticancer activities. Its structure allows for various modifications, which can lead to derivatives with enhanced efficacy or selectivity. As with many thiosemicarbazides, it may also participate in redox reactions, making it a candidate for further research in the development of therapeutic agents. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C10H14N2OS
InChI:InChI=1/C10H14N2OS/c1-11-10(14)12-7-8-3-5-9(13-2)6-4-8/h3-6H,7H2,1-2H3,(H2,11,12,14)
InChI key:RJYHJXVBSQAYNL-UHFFFAOYSA-N
SMILES:CN=C(NCc1ccc(cc1)OC)S
Synonyms:
  • N-(4-methoxybenzyl)hydrazinecarbothioamide
  • 1-(4-Methoxybenzyl)-3-Methylthiourea
Found 3 products.