CymitQuimica logo

CAS 167366-05-4

:

4-Bromothiazole-2-carboxaldehyde

Description:
4-Bromothiazole-2-carboxaldehyde is an organic compound characterized by its thiazole ring, which contains both sulfur and nitrogen atoms, contributing to its unique chemical properties. The presence of a bromine atom at the 4-position and an aldehyde functional group at the 2-position enhances its reactivity, making it useful in various synthetic applications. This compound typically appears as a solid or liquid, depending on the specific conditions, and is soluble in polar organic solvents. Its molecular structure allows for potential interactions in biological systems, making it of interest in medicinal chemistry and drug development. Additionally, the compound may exhibit properties such as antimicrobial or antifungal activity, which are common in thiazole derivatives. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling procedures should be followed. Overall, 4-Bromothiazole-2-carboxaldehyde serves as a valuable intermediate in organic synthesis and pharmaceutical research.
Formula:C4H2BrNOS
InChI:InChI=1S/C4H2BrNOS/c5-3-2-8-4(1-7)6-3/h1-2H
InChI key:JDUXMFGFGCJNGO-UHFFFAOYSA-N
SMILES:C1=C(N=C(S1)C=O)Br
Synonyms:
  • 2-Thiazolecarboxaldehyde, 4-bromo-
  • 4-Bromo-1,3-thiazole-2-carboxaldehyde
  • 4-Bromothiazol-2-carboxaldehyde
  • 4-Bromo-2-Formylthiazole
Found 5 products.