CAS 1674-48-2
:ethanesulfonic acid - 2-{4-[3-(2-chloro-10H-phenothiazin-10-yl)propyl]piperazin-1-yl}ethyl 3,4,5-trimethoxybenzoate (2:1)
Description:
Ethanesulfonic acid, specifically the compound with the name "2-{4-[3-(2-chloro-10H-phenothiazin-10-yl)propyl]piperazin-1-yl}ethyl 3,4,5-trimethoxybenzoate (2:1)" and CAS number 1674-48-2, is a complex organic molecule characterized by its multi-functional groups. This compound features a piperazine moiety, which is known for its role in pharmacological applications, and a phenothiazine structure, often associated with antipsychotic properties. The presence of the ethyl and trimethoxybenzoate groups suggests potential solubility in organic solvents and possible interactions with biological systems. The chloro substituent on the phenothiazine ring may enhance the compound's reactivity and influence its pharmacokinetic properties. Ethanesulfonic acid derivatives are typically utilized in various chemical syntheses and may exhibit unique biological activities, making them of interest in medicinal chemistry. Overall, this compound's intricate structure indicates potential utility in therapeutic applications, although specific biological effects and mechanisms would require further investigation.
Formula:C35H48ClN3O11S3
InChI:InChI=1/C31H36ClN3O5S.2C2H6O3S/c1-37-26-19-22(20-27(38-2)30(26)39-3)31(36)40-18-17-34-15-13-33(14-16-34)11-6-12-35-24-7-4-5-8-28(24)41-29-10-9-23(32)21-25(29)35;2*1-2-6(3,4)5/h4-5,7-10,19-21H,6,11-18H2,1-3H3;2*2H2,1H3,(H,3,4,5)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Methophenazine diethanesulfonate
CAS:Methophenazine diethanesulfonate is a Calmodulin antagonist.Formula:C35H48ClN3O11S3Color and Shape:SolidMolecular weight:818.41
