CAS 167412-23-9
:N-(3,5-Difluorophenyl)hydrazinecarboxamide
Description:
N-(3,5-Difluorophenyl)hydrazinecarboxamide is a chemical compound characterized by its hydrazine and carboxamide functional groups, along with a difluorophenyl substituent. This compound typically exhibits properties associated with both hydrazines and amides, such as potential reactivity due to the presence of the hydrazine moiety, which can participate in various chemical reactions, including condensation and oxidation. The difluorophenyl group contributes to its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The presence of fluorine atoms often enhances the compound's metabolic stability and can modulate its interaction with biological targets. In terms of physical properties, it may exhibit moderate solubility in organic solvents and limited solubility in water, typical of many hydrazine derivatives. Additionally, the compound's structure suggests potential applications in pharmaceuticals, particularly in the development of agents targeting specific biological pathways. As with many chemical substances, safety precautions should be observed when handling due to potential toxicity associated with hydrazine derivatives.
Formula:C7H7F2N3O
InChI:InChI=1S/C7H7F2N3O/c8-4-1-5(9)3-6(2-4)11-7(13)12-10/h1-3H,10H2,(H2,11,12,13)
InChI key:InChIKey=SBMUAPSDDKLAPV-UHFFFAOYSA-N
SMILES:N(C(NN)=O)C1=CC(F)=CC(F)=C1
Synonyms:- 1-Amino-3-(3,5-difluorophenyl)urea
- 3-Amino-1-(3,5-difluorophenyl)urea
- Hydrazine carboxamide, N-(3,5-difluorophenyl-)
- Hydrazinecarboxamide, N-(3,5-difluorophenyl)-
- N-(3,5-Difluorophenyl)hydrazinecarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Ref: 4Z-U-0649
Discontinued product
