CAS 16744-81-3
:4-Methoxy-2-pyridinecarboxaldehyde
Description:
4-Methoxy-2-pyridinecarboxaldehyde, with the CAS number 16744-81-3, is an organic compound characterized by its pyridine ring structure substituted with a methoxy group and an aldehyde functional group. This compound typically appears as a pale yellow to light brown liquid or solid, depending on its purity and form. It has a molecular formula that reflects its aromatic nature, contributing to its potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. The presence of the methoxy group enhances its solubility in organic solvents, while the aldehyde functionality allows for reactivity in various chemical reactions, such as condensation and oxidation. Additionally, 4-Methoxy-2-pyridinecarboxaldehyde may exhibit biological activity, making it of interest in medicinal chemistry. Its properties, including boiling point, melting point, and spectral characteristics, can vary based on the specific conditions and purity of the sample. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity and reactivity.
Formula:C7H7NO2
InChI:InChI=1/C7H7NO2/c1-10-7-2-3-8-6(4-7)5-9/h2-5H,1H3
InChI key:InChIKey=UEVABMBUZNGYQI-UHFFFAOYSA-N
SMILES:O(C)C=1C=C(C=O)N=CC1
Synonyms:- 2-Pyridinecarboxaldehyde, 4-methoxy-
- 4-Methoxy-2-Pyridinecarboxaldehyde
- 4-Methoxy-2-formylpyridine
- 4-Methoxypyridine-2-Carbaldehyde
- 4-Methoxypyridine-2-aldehyde
- 4-Methoxypyridine-2-carboxaldehyde
- Picolinaldehyde, 4-methoxy-
- 4-Methoxy-2-pyridinecarbaldehyde
- 2-Formyl-4-methoxypyridine, 4-Methoxypicolinaldehyde
- 4-METHOXYPICOLINALDEHYDE
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Pyridinecarboxaldehyde, 4-methoxy-
CAS:Formula:C7H7NO2Purity:98%Color and Shape:SolidMolecular weight:137.1360Ref: IN-DA001XEA
50gTo inquire100gTo inquire100mg26.00€250mg31.00€1g60.00€5g131.00€10g206.00€25g342.00€4-Methoxypyridine-2-carboxaldehyde
CAS:4-Methoxypyridine-2-carboxaldehydeFormula:C7H7NO2Purity:99%Color and Shape: yellow liquidMolecular weight:137.14g/mol4-Methoxypyridine-2-carboxaldehyde
CAS:4-Methoxypyridine-2-carboxaldehyde (4MPCA) is a chemical with antihistaminergic properties that can be used as a histamine antagonist. 4MPCA is synthesized from the reaction of 4-methoxypyridine, formaldehyde, and chloroacetic acid. The compound has been shown to inhibit the H2 receptor at concentrations of 1 x 10 M. It also has been shown to possess antiproliferative activity in tumor cell lines. This compound is unique because it contains a heterocyclic moiety in its structure and can be used in cross-coupling reactions.Formula:C7H7NO2Purity:Min. 95%Molecular weight:137.14 g/mol




