CymitQuimica logo

CAS 167482-99-7

:

Benzoic acid, 4-(di-1H-pyrrol-2-ylmethyl)-, methyl ester

Description:
Benzoic acid, 4-(di-1H-pyrrol-2-ylmethyl)-, methyl ester, identified by CAS number 167482-99-7, is an organic compound characterized by its ester functional group and the presence of pyrrole rings. This compound features a benzoic acid backbone, which contributes to its aromatic properties, while the di-1H-pyrrol-2-ylmethyl substituents enhance its potential for biological activity. The methyl ester group indicates that it is a methyl ester derivative, which typically influences its solubility and reactivity. The presence of the pyrrole moieties suggests potential applications in medicinal chemistry, as pyrrole derivatives are often associated with various pharmacological activities. Additionally, the compound may exhibit interesting physical properties, such as melting and boiling points, which are influenced by its molecular structure and intermolecular interactions. Overall, this compound's unique structure may render it valuable in research and development, particularly in the fields of organic synthesis and drug discovery.
Formula:C17H16N2O2
InChI:InChI=1S/C17H16N2O2/c1-21-17(20)13-8-6-12(7-9-13)16(14-4-2-10-18-14)15-5-3-11-19-15/h2-11,16,18-19H,1H3
InChI key:IMQPCUGJFLINEV-UHFFFAOYSA-N
SMILES:COC(=O)C1=CC=C(C=C1)C(C2=CC=CN2)C3=CC=CN3
Found 3 products.