CAS 167484-72-2

Spiro[benzofuran-3(2H),4′-piperidine], hydrochloride (1:1)

Description:

Spiro[benzofuran-3(2H),4′-piperidine], hydrochloride (1:1), identified by its CAS number 167484-72-2, is a chemical compound characterized by its unique spirocyclic structure, which combines a benzofuran moiety with a piperidine ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the hydrochloride salt form indicates that it is a protonated version of the base compound, which can enhance its solubility in aqueous environments, making it suitable for various applications, including pharmacological studies. The spiro configuration often imparts distinctive stereochemical properties, which can influence the compound's interaction with biological targets. Additionally, compounds of this nature may exhibit a range of activities, including neuropharmacological effects, due to their structural similarities to known neurotransmitter modulators. Overall, the characteristics of this compound suggest potential utility in medicinal chemistry and drug development, although specific biological activities and mechanisms would require further investigation.

Formula: C₁₂H₁₅NO·ClH

InChI: InChI=1S/C12H15NO.ClH/c1-2-4-11-10(3-1)12(9-14-11)5-7-13-8-6-12;/h1-4,13H,5-9H2;1H

InChI key: InChIKey=XKXOUCZJTAESPR-UHFFFAOYSA-N

SMILES: C12(C=3C(OC1)=CC=CC3)CCNCC2.Cl

Synonyms:

• Spiro[benzofuran-3(2H),4′-piperidine], hydrochloride
• 2H-Spiro[benzofuran-3,4′-piperidine] hydrochloride
• 2,3-Dihydrospiro[benzofuran-3,4′-piperidine] hydrochloride
• Spiro[benzofuran-3(2H),4′-piperidine], hydrochloride (1:1)

2H-Spiro[1-benzofuran-3,4'-piperidine] hydrochloride

CAS: 167484-72-2

Versatile small molecule scaffold

Formula: C₁₂H₁₆ClNO

Purity: Min. 95%

Molecular weight: 225.71 g/mol

Ref: 3D-SGA48472