CAS 1675-58-7
:Diphenylgermane
Description:
Diphenylgermane is an organometallic compound characterized by the presence of a germanium atom bonded to two phenyl groups. Its molecular formula is C12H10Ge, and it belongs to the class of organogermanes. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature. Diphenylgermane is known for its relatively low volatility and moderate solubility in organic solvents, making it useful in various chemical applications. It exhibits properties similar to those of organosilicon compounds, which allows it to participate in reactions typical of organometallics, such as nucleophilic substitution and coupling reactions. Additionally, diphenylgermane can act as a precursor for the synthesis of other germanium-containing compounds and materials. However, it should be handled with care due to potential toxicity and environmental concerns associated with organometallic compounds. Overall, diphenylgermane is a valuable compound in the field of organometallic chemistry and materials science.
Formula:C12H12Ge
InChI:InChI=1/C12H12Ge/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10H,13H2
SMILES:c1ccc(cc1)[GeH2]c1ccccc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.