CAS 1675-71-4
:2,2'-(2,3,5,6-tetramethylbenzene-1,4-diyl)diacetonitrile
Description:
2,2'-(2,3,5,6-tetramethylbenzene-1,4-diyl)diacetonitrile, with the CAS number 1675-71-4, is an organic compound characterized by its structure, which features a central aromatic ring substituted with four methyl groups and two acetonitrile functional groups. This compound is typically a solid at room temperature and is known for its relatively high melting point. The presence of the nitrile groups contributes to its polarity, making it soluble in polar organic solvents. The tetramethyl substitution on the benzene ring enhances its steric bulk, which can influence its reactivity and interactions with other molecules. Additionally, the compound may exhibit interesting optical properties due to its conjugated system. It is often used in synthetic organic chemistry and materials science, particularly in the development of polymers and as a building block for more complex molecules. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C14H16N2
InChI:InChI=1/C14H16N2/c1-9-10(2)14(6-8-16)12(4)11(3)13(9)5-7-15/h5-6H2,1-4H3
SMILES:Cc1c(C)c(CC#N)c(C)c(C)c1CC#N
Synonyms:- 1,4-Benzenediacetonitrile, 2,3,5,6-Tetramethyl-
- 2,2'-(2,3,5,6-Tetramethyl-1,4-Phenylene)Diacetonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
