CAS 167556-64-1

2-Methyl-5-(tributylstannyl)pyridine

Description:

2-Methyl-5-(tributylstannyl)pyridine is an organotin compound characterized by the presence of a pyridine ring substituted with a methyl group and a tributylstannyl group. The molecular structure features a nitrogen atom in the pyridine ring, which contributes to its basicity and potential reactivity. The tributylstannyl group, consisting of three butyl chains attached to a tin atom, imparts unique properties such as increased lipophilicity and potential applications in organometallic chemistry. This compound is typically used in various synthetic applications, including as a reagent in organic synthesis and as a precursor in the preparation of other organotin derivatives. Its stability and solubility in organic solvents make it suitable for use in diverse chemical reactions. However, due to the presence of tin, it is essential to handle this compound with care, considering the environmental and health implications associated with organotin compounds. Overall, 2-Methyl-5-(tributylstannyl)pyridine is a valuable compound in the field of synthetic organic chemistry.

Formula: C₁₈H₃₃NSn

InChI: InChI=1S/C6H6N.3C4H9.Sn/c1-6-4-2-3-5-7-6;3*1-3-4-2;/h2,4-5H,1H3;3*1,3-4H2,2H3;

InChI key: InChIKey=GQSHSSUYFVJPOO-UHFFFAOYSA-N

SMILES: [Sn](CCCC)(CCCC)(CCCC)C=1C=CC(C)=NC1

Synonyms:

• 2-Methyl-5-(tributylstannyl)pyridine
• Pyridine, 2-methyl-5-(tributylstannyl)-

Pyridine, 2-methyl-5-(tributylstannyl)-

CAS: 167556-64-1

Formula: C₁₈H₃₃NSn

Purity: 96%

Molecular weight: 382.1623

Ref: IN-DA001XFZ

2-Methyl-5-(tributylstannyl)pyridine

Controlled Product

CAS: 167556-64-1

Please enquire for more information about 2-Methyl-5-(tributylstannyl)pyridine including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₈H₃₃NSn

Purity: Min. 95%

Molecular weight: 382.17 g/mol

Ref: 3D-FM29333