CymitQuimica logo

CAS 1676-57-9

:

5-BROMO-2-METHYL-4(1H)-PYRIMIDINONE

Description:
5-Bromo-2-methyl-4(1H)-pyrimidinone is a heterocyclic organic compound characterized by a pyrimidine ring substituted with a bromine atom and a methyl group. Its molecular structure features a carbon-nitrogen framework typical of pyrimidines, with the bromine substituent located at the 5-position and a methyl group at the 2-position. This compound is known for its potential applications in medicinal chemistry, particularly as a building block in the synthesis of pharmaceuticals and agrochemicals. It exhibits properties such as moderate solubility in polar solvents and stability under standard laboratory conditions. The presence of the bromine atom can enhance its reactivity, making it useful in various chemical reactions, including nucleophilic substitutions. Additionally, the compound may exhibit biological activity, which is of interest for further research in drug development. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks. Overall, 5-bromo-2-methyl-4(1H)-pyrimidinone is a valuable compound in organic synthesis and pharmaceutical research.
Formula:C5H5BrN2O
InChI:InChI=1/C5H5BrN2O/c1-3-7-2-4(6)5(9)8-3/h2H,1H3,(H,7,8,9)
InChI key:WXBZTJGZVILJIA-UHFFFAOYSA-N
SMILES:Cc1ncc(c(n1)O)Br
Synonyms:
  • 4-Pyrimidinol, 5-Bromo-2-Methyl-
  • 5-Bromo-2-methylpyrimidin-4-ol
  • 5-Bromo-4-hydroxy-2-methylpyrimidine
  • 5-bromo-2-methylpyrimidin-4(3H)-one
Found 4 products.