CAS 167612-35-3
:(2S,3R,4S,5S,6R)-3,4,5-tribenzyloxy-2-methyl-6-phenylsulfanyl-tetrahydropyran
Description:
The chemical substance known as (2S,3R,4S,5S,6R)-3,4,5-tribenzyloxy-2-methyl-6-phenylsulfanyl-tetrahydropyran, with the CAS number 167612-35-3, is a complex organic compound characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether. This compound features multiple functional groups, including three benzyloxy groups, a methyl group, and a phenylsulfanyl group, contributing to its unique reactivity and potential applications in organic synthesis. The stereochemistry indicated by the (2S,3R,4S,5S,6R) configuration suggests specific spatial arrangements of the substituents, which can influence the compound's biological activity and interaction with other molecules. The presence of the sulfur atom in the phenylsulfanyl group may impart distinct electronic properties, making it of interest in medicinal chemistry and materials science. Overall, this compound exemplifies the complexity and diversity of organic molecules, with potential implications in various fields, including pharmaceuticals and chemical research.
Formula:C33H34O4S
InChI:InChI=1/C33H34O4S/c1-25-30(34-22-26-14-6-2-7-15-26)31(35-23-27-16-8-3-9-17-27)32(36-24-28-18-10-4-11-19-28)33(37-25)38-29-20-12-5-13-21-29/h2-21,25,30-33H,22-24H2,1H3/t25-,30+,31-,32-,33+/m0/s1
Synonyms:- Phenyl 2,3,4-tri-O-benzyl-6-deoxy-1-thio-β-L-gulopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Phenyl 2,3,4-Tri-O-Benzyl-1-Thio-β-L-Fucopyranoside
CAS:Formula:C33H34O4SPurity:98.0%Color and Shape:SolidMolecular weight:526.6857Phenyl 2,3,4-Tri-O-benzyl-1-thio-β-L-fucopyranoside
CAS:Formula:C33H34O4SPurity:>98.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:526.69Phenyl 2,3,4-tri-O-benzyl-b-L-thiofucopyranose
CAS:<p>Phenyl 2,3,4-tri-O-benzyl-b-L-thiofucopyranose is a synthetic monosaccharide that is modified with fluorine. It is also known as 3,4,6-tri-O-benzyl-2,3,4,6-tetra-O-(trifluoromethyl) fucopyranose. This compound is a complex carbohydrate that belongs to the group of glycoconjugates and polysaccharides. Phenyl 2,3,4-tri-O-benzyl-b-L-thiofucopyranose has been shown to be useful in glycosylation reactions as well as in click chemistry reactions. This compound can be used for the synthesis of oligosaccharides and polysaccharides with custom modifications. Phenyl 2,3,4 tri O benzyl b L thiof</p>Formula:C33H34O4SPurity:Min. 95%Color and Shape:PowderMolecular weight:526.69 g/mol


