CAS 167612-35-3: (2S,3R,4S,5S,6R)-3,4,5-tribenzyloxy-2-methyl-6-phenylsulfanyl-tetrahydropyran
Description:The chemical substance known as (2S,3R,4S,5S,6R)-3,4,5-tribenzyloxy-2-methyl-6-phenylsulfanyl-tetrahydropyran, with the CAS number 167612-35-3, is a complex organic compound characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether. This compound features multiple functional groups, including three benzyloxy groups, a methyl group, and a phenylsulfanyl group, contributing to its unique reactivity and potential applications in organic synthesis. The stereochemistry indicated by the (2S,3R,4S,5S,6R) configuration suggests specific spatial arrangements of the substituents, which can influence the compound's biological activity and interaction with other molecules. The presence of the sulfur atom in the phenylsulfanyl group may impart distinct electronic properties, making it of interest in medicinal chemistry and materials science. Overall, this compound exemplifies the complexity and diversity of organic molecules, with potential implications in various fields, including pharmaceuticals and chemical research.
Formula:C33H34O4S
InChI:InChI=1/C33H34O4S/c1-25-30(34-22-26-14-6-2-7-15-26)31(35-23-27-16-8-3-9-17-27)32(36-24-28-18-10-4-11-19-28)33(37-25)38-29-20-12-5-13-21-29/h2-21,25,30-33H,22-24H2,1H3/t25-,30+,31-,32-,33+/m0/s1
- Synonyms:
- Phenyl 2,3,4-tri-O-benzyl-6-deoxy-1-thio-β-L-gulopyranoside

β-L-Galactopyranoside, phenyl 6-deoxy-2,3,4-tris-O-(phenylmethyl)-1-thio-
Ref: IN-DA001XHF
Undefined size | To inquire |

Phenyl 2,3,4-Tri-O-benzyl-1-thio-β-L-fucopyranoside
Ref: 3B-P1842
1g | 222.00 € | ||
5g | 840.00 € |

Phenyl 2,3,4-tri-O-benzyl-b-L-thiofucopyranose
Ref: 3D-MP10936
5g | 278.00 € | ||
10g | 470.00 € | ||
25g | 769.00 € |