CAS 167626-64-4
:3-(1H-1,2,4-TRIAZOL-1-YL)BENZOIC ACID
Description:
3-(1H-1,2,4-Triazol-1-yl)benzoic acid is an organic compound characterized by the presence of a benzoic acid moiety substituted with a 1H-1,2,4-triazole group. This compound features a triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms, contributing to its unique chemical properties. The benzoic acid part of the molecule provides acidic characteristics due to the carboxylic acid functional group (-COOH), which can participate in hydrogen bonding and act as a proton donor. The presence of the triazole ring enhances the compound's potential for biological activity, making it of interest in pharmaceutical research. Additionally, the compound may exhibit solubility in polar solvents and could participate in various chemical reactions, such as esterification or amidation, due to the functional groups present. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of antimicrobial or antifungal agents. Overall, 3-(1H-1,2,4-triazol-1-yl)benzoic acid is a versatile compound with significant implications in chemical and biological research.
Formula:C9H7N3O2
InChI:InChI=1/C9H7N3O2/c13-9(14)7-2-1-3-8(4-7)12-6-10-5-11-12/h1-6H,(H,13,14)
SMILES:c1cc(cc(c1)n1cncn1)C(=O)O
Synonyms:- 3-(1H-1,2,4-Triazol-1-yl)benzoic acid 97%
- 3-(1,2,4-Triazol-1-yl)benzoic Acid
- 3-(1H-1,2,4-TRIAZOL-1-YL)BENZOIC ACID
- 1-(3-Carboxyphenyl)-1H-1,2,4-triazole
- Benzoic acid, 3-(1H-1,2,4-triazol-1-yl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzoic acid, 3-(1H-1,2,4-triazol-1-yl)-
CAS:Formula:C9H7N3O2Purity:97%Color and Shape:SolidMolecular weight:189.17083-(1H-1,2,4-Triazol-1-yl)benzoic acid
CAS:3-(1H-1,2,4-Triazol-1-yl)benzoic acidPurity:97%Color and Shape:Off-White PowderMolecular weight:189.17g/mol3-(1H-1,2,4-Triazol-1-yl)benzoic acid
CAS:Formula:C9H7N3O2Purity:97%Color and Shape:SolidMolecular weight:189.1743-(1H-1,2,4-Triazol-1-yl)benzoic acid
CAS:3-(1H-1,2,4-Triazol-1-yl)benzoic acid is a supramolecular compound that has been shown to exhibit a transition from the low-temperature phase to the high-temperature phase when exposed to UV irradiation. It also has a magnetic property and can be coordinated with metal ions. The compound has been shown to have synergistic effects with other drugs such as erythromycin, which may be due to its ability to bind with DNA or RNA. 3-(1H-1,2,4-Triazol-1-yl)benzoic acid has also been shown to have anti-inflammatory properties. The compound inhibits the production of prostaglandins by blocking the enzyme cyclooxygenase, which is required for prostaglandin synthesis in cells.
Formula:C9H7N3O2Purity:Min. 95%Molecular weight:189.17 g/mol



