CAS 1677-30-1
:N1,N3-Bis(3,4-dichlorophenyl)propanediamide
Description:
N1,N3-Bis(3,4-dichlorophenyl)propanediamide, with the CAS number 1677-30-1, is a synthetic organic compound characterized by its amide functional groups and a propanediamide backbone. This compound features two 3,4-dichlorophenyl groups attached to the nitrogen atoms of the amide, contributing to its unique chemical properties. It is typically solid at room temperature and may exhibit a crystalline structure. The presence of chlorine atoms enhances its lipophilicity and may influence its biological activity. This compound is of interest in various fields, including medicinal chemistry and agrochemicals, due to its potential applications in pharmaceuticals and as a pesticide. Its stability, solubility, and reactivity can vary depending on the solvent and environmental conditions. Safety data should be consulted for handling, as compounds with halogenated aromatic groups can pose environmental and health risks. Overall, N1,N3-Bis(3,4-dichlorophenyl)propanediamide is a notable compound for research and development in chemical applications.
Formula:C15H10Cl4N2O2
InChI:InChI=1S/C15H10Cl4N2O2/c16-10-3-1-8(5-12(10)18)20-14(22)7-15(23)21-9-2-4-11(17)13(19)6-9/h1-6H,7H2,(H,20,22)(H,21,23)
InChI key:InChIKey=USNJUUHHKPWGHO-UHFFFAOYSA-N
SMILES:N(C(CC(NC1=CC(Cl)=C(Cl)C=C1)=O)=O)C2=CC(Cl)=C(Cl)C=C2
Synonyms:- Malonanilide, 3′,3′′,4′,4′′-tetrachloro-
- Propanediamide, N1,N3-bis(3,4-dichlorophenyl)-
- Propanediamide, N,N′-bis(3,4-dichlorophenyl)-
- N1,N3-Bis(3,4-dichlorophenyl)propanediamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
