CAS 1677-47-0
:4,5-DICHLORO-1H-INDOLE-2,3-DIONE
Description:
4,5-Dichloro-1H-indole-2,3-dione, with the CAS number 1677-47-0, is a synthetic organic compound characterized by its indole structure, which features a fused bicyclic system containing a nitrogen atom. This compound is notable for the presence of two chlorine atoms at the 4 and 5 positions of the indole ring, contributing to its reactivity and potential biological activity. The dione functional groups at positions 2 and 3 indicate the presence of two carbonyl groups, which can participate in various chemical reactions, including nucleophilic additions and cycloadditions. 4,5-Dichloro-1H-indole-2,3-dione is often used in organic synthesis and medicinal chemistry, where it may serve as an intermediate in the development of pharmaceuticals or agrochemicals. Its properties, such as solubility and stability, can vary depending on the solvent and environmental conditions. Additionally, the compound's structure suggests potential interactions with biological systems, making it a subject of interest in research related to drug design and development.
Formula:C8H3Cl2NO2
InChI:InChI=1/C8H3Cl2NO2/c9-3-1-2-4-5(6(3)10)7(12)8(13)11-4/h1-2H,(H,11,12,13)
SMILES:c1cc2c(c(c1Cl)Cl)C(=O)C(=O)N2
Synonyms:- 4,5-Dichloroisatin
- Buttpark 50\07-97
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1H-Indole-2,3-dione, 4,5-dichloro-
CAS:Formula:C8H3Cl2NO2Purity:95%Color and Shape:SolidMolecular weight:216.02094,5-Dichloroindoline-2,3-dione
CAS:4,5-Dichloroindoline-2,3-dionePurity:97%Molecular weight:216.023g/mol4,5-Dichloroisatin
CAS:<p>4,5-Dichloroisatin is a versatile building block that can be used as a reagent for research and as a speciality chemical. It is also useful in the synthesis of complex compounds. 4,5-Dichloroisatin is a high quality compound with a CAS number of 1677-47-0. This compound is not intended for use in humans or animals.</p>Formula:C8H3Cl2NO2Purity:Min. 95%Color and Shape:Yellow PowderMolecular weight:216.02 g/mol
