CymitQuimica logo

CAS 1677-50-5

:

2,4,6-Trichloroquinoline

Description:
2,4,6-Trichloroquinoline is a synthetic organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of three chlorine atoms at the 2, 4, and 6 positions of the quinoline ring significantly influences its chemical properties, including its reactivity and solubility. This compound is typically a pale yellow to brown solid and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. It exhibits moderate stability under standard conditions but can undergo reactions typical of chlorinated aromatic compounds, such as nucleophilic substitution and electrophilic aromatic substitution. Additionally, 2,4,6-Trichloroquinoline may possess biological activity, making it of interest in medicinal chemistry. However, its environmental impact and toxicity should be carefully evaluated, as chlorinated compounds can pose risks to both human health and ecosystems. Proper handling and disposal protocols are essential when working with this substance to mitigate any potential hazards.
Formula:C9H4Cl3N
InChI:InChI=1S/C9H4Cl3N/c10-5-1-2-8-6(3-5)7(11)4-9(12)13-8/h1-4H
InChI key:InChIKey=ALESUIVUHLTNLB-UHFFFAOYSA-N
SMILES:ClC=1C2=C(N=C(Cl)C1)C=CC(Cl)=C2
Synonyms:
  • 2,4,6-Trichloroquinoline
  • Quinoline, 2,4,6-trichloro-
Found 5 products.