CAS 1677-80-1

3,4-Dichloropyridazine

Description:

3,4-Dichloropyridazine is a heterocyclic organic compound characterized by a pyridazine ring, which is a six-membered ring containing two nitrogen atoms at positions 1 and 2. The presence of two chlorine atoms at the 3 and 4 positions of the ring significantly influences its chemical properties, making it a chlorinated derivative of pyridazine. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It is known for its potential applications in agrochemicals, pharmaceuticals, and as an intermediate in organic synthesis. The chlorine substituents enhance its reactivity, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, 3,4-Dichloropyridazine exhibits moderate to low solubility in water but is more soluble in organic solvents, which is a common trait for many chlorinated compounds. Safety data indicates that it should be handled with care due to potential toxicity and environmental impact, necessitating appropriate safety measures during its use and disposal.

Formula: C₄H₂Cl₂N₂

InChI: InChI=1/C4H2Cl2N2/c5-3-1-2-7-8-4(3)6/h1-2H

InChI key: InChIKey=JADVVTZXHQUFLS-UHFFFAOYSA-N

SMILES: ClC1=C(Cl)N=NC=C1

Synonyms:

• NSC 73470
• 3,4-Dichloropyridazine
• Pyridazine, 3,4-dichloro-
• 3,4-dichloropyridazine ISO 9001：2015 REACH

Pyridazine, 3,4-dichloro-

CAS: 1677-80-1

Formula: C₄H₂Cl₂N₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 148.9781

Ref: IN-DA001XJI

3,4-Dichloropyridazine

CAS: 1677-80-1

3,4-Dichloropyridazine

Purity: 98%

Molecular weight: 148.98g/mol

Ref: 54-OR925203

3,4-Dichloropyridazine

CAS: 1677-80-1

Formula: C₄H₂Cl₂N₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 148.97

Ref: 10-F091854