CAS 167710-87-4

1-[4-AMINO-5-CHLORO-2-(3,5-DIMETHOXYPHENYL)METHYLOXY]-3-[[1-[2-METHYLSULPHONYLAMINO]ETHYL]PIPERIDIN-4-YL]PROPAN-1-ONE HYDROCHLORIDE

Description:

The chemical substance known as 1-[4-amino-5-chloro-2-(3,5-dimethoxyphenyl)methyloxy]-3-[[1-[2-methylsulphonylamino]ethyl]piperidin-4-yl]propan-1-one hydrochloride, with CAS number 167710-87-4, is a complex organic compound characterized by its multi-functional groups. It features an amino group, a chloro substituent, and methoxy groups, which contribute to its potential biological activity. The presence of a piperidine ring suggests it may interact with various biological targets, possibly influencing neurotransmitter systems. The sulfonamide moiety indicates potential for pharmacological applications, particularly in medicinal chemistry. This compound is typically studied for its therapeutic properties, and its hydrochloride form enhances solubility in aqueous environments, making it suitable for various formulations. As with many synthetic organic compounds, its stability, reactivity, and biological interactions are influenced by its structural features, which can be explored further in pharmacological studies. Safety and handling precautions are essential due to its complex nature and potential bioactivity.

Formula: C₂₆H₃₇Cl₂N₃O₆S

InChI: InChI=1/C26H36ClN3O6S.ClH/c1-34-20-12-19(13-21(14-20)35-2)17-36-26-16-24(28)23(27)15-22(26)25(31)5-4-18-6-9-30(10-7-18)11-8-29-37(3,32)33;/h12-16,18,29H,4-11,17,28H2,1-3H3;1H

SMILES: COc1cc(cc(c1)OC)COc1cc(c(cc1C(=O)CCC1CCN(CC1)CCNS(=O)(=O)C)Cl)N.Cl

Synonyms:

• Rs 39604 Hydrochloride
• 1-(4-Amino-5-chloro-2-(3,5-dimethoxyphenyl)methyloxy)-3-(1-(2-methylsulfonylamino)ethyl)piperidin-4-yl)propan-1-onehyd
• RS39604HCl
• N-{2-[4-(3-{4-amino-5-chloro-2-[(3,5-dimethoxybenzyl)oxy]phenyl}-3-oxopropyl)piperidin-1-yl]ethyl}methanesulfonamide hydrochloride

RS 39604 hydrochloride

CAS: 167710-87-4

RS 39604 hydrochloride is a mitochondrial function inhibitor that blocks the uptake of mitochondrial substrates, thereby inhibiting the synthesis of ATP. RS 39604 hydrochloride is also an inhibitor of 5-HT1A receptors, which are found in the striatal membranes and play a role in regulating dopamine release. These properties make RS 39604 hydrochloride a potential therapeutic agent for conditions such as Parkinson's disease and cardiac arrhythmia.

Formula: C₁₆H₂₄Cl₂N₂O₃

Purity: Min. 95%

Molecular weight: 363.3 g/mol

Ref: 3D-SGA71087

RS 39604

CAS: 167710-87-4

potent and selective 5-HT4 antagonist

Formula: C₂₆H₃₇Cl₂N₃O₆S

Purity: 98%

Color and Shape: Solid

Molecular weight: 590.56

Ref: TM-T23260