CAS 16778-22-6

3-Chloro-8-methoxy-4-quinolinol

Description:

3-Chloro-8-methoxy-4-quinolinol is a chemical compound characterized by its quinoline structure, which consists of a bicyclic aromatic system. This compound features a chlorine atom at the 3-position and a methoxy group at the 8-position of the quinoline ring, along with a hydroxyl group at the 4-position. The presence of these functional groups contributes to its potential biological activity, making it of interest in medicinal chemistry. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in pharmaceuticals, particularly as an antimicrobial or antiprotozoal agent, due to the known activity of similar quinoline derivatives. Additionally, the chlorine and methoxy substituents can influence the compound's reactivity and interaction with biological targets. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or environmental impact.

Formula: C₁₀H₈ClNO₂

InChI: InChI=1S/C10H8ClNO2/c1-14-8-4-2-3-6-9(8)12-5-7(11)10(6)13/h2-5H,1H3,(H,12,13)

InChI key: InChIKey=QBTBXSAXOFOZIA-UHFFFAOYSA-N

SMILES: O(C)C=1C2=C(C(O)=C(Cl)C=N2)C=CC1

Synonyms:

• 3-Chloro-8-methoxy-4-quinolinol
• 4-Quinolinol, 3-chloro-8-methoxy-

4-Quinolinol, 3-chloro-8-methoxy-

CAS: 16778-22-6

Formula: C₁₀H₈ClNO₂

Molecular weight: 209.629

Ref: IN-DA001XLR

3-Chloro-4-hydroxy-8-methoxyquinoline

CAS: 16778-22-6

3-Chloro-4-hydroxy-8-methoxyquinoline

Purity: ≥95%

Molecular weight: 209.63g/mol

Ref: 54-OR308239