CAS 1678-53-1
:3-Methyl-4-nitropyridine
Description:
3-Methyl-4-nitropyridine is an organic compound characterized by a pyridine ring substituted with both a methyl group and a nitro group. Its molecular formula is C6H6N2O2, indicating the presence of carbon, hydrogen, nitrogen, and oxygen atoms. This compound typically appears as a yellow to brown solid and is known for its aromatic properties due to the pyridine structure. It has a relatively high melting point and is soluble in organic solvents, making it useful in various chemical applications. The nitro group contributes to its reactivity, allowing it to participate in electrophilic substitution reactions. 3-Methyl-4-nitropyridine is often utilized in the synthesis of pharmaceuticals, agrochemicals, and other nitrogen-containing compounds. Additionally, it may exhibit biological activity, which can be of interest in medicinal chemistry. As with many nitro compounds, it should be handled with care due to potential toxicity and environmental concerns. Proper safety measures should be observed when working with this substance in laboratory settings.
Formula:C6H6N2O2
InChI:InChI=1S/C6H6N2O2/c1-5-4-7-3-2-6(5)8(9)10/h2-4H,1H3
InChI key:InChIKey=UYAWSMUOLFSNGC-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C(C)=CN=CC1
Synonyms:- 3-Picoline, 4-nitro-
- 4-Nitro-3-Picoline
- 4-Nitro-3-Picoline Hcl
- 4-Nitro-3-picoline hydrochloride
- Iflab-Bb F1371-0142
- Pyridine, 3-methyl-4-nitro-
- 3-Methyl-4-nitropyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Nitro-3-methylpyridine
CAS:Formula:C6H6N2O2Purity:97%Color and Shape:SolidMolecular weight:138.12404-Nitro-3-picoline
CAS:4-Nitro-3-picoline (NPP) is a colorless liquid that has an intramolecular hydrogen bond. It reacts with water to form the corresponding nitrate, which is a strong oxidizer. 4-Nitro-3-picoline has been shown to have optical properties that are sensitive to changes in pH and temperature. This compound also has dipole, n-oxide, and hydroxyl functional groups that can be used for chemical reactions. 4-Nitro-3-picoline is a type species of 5-azaindole and can be used as a precursor in the synthesis of other compounds such as dyes. NPP also has supramolecular properties that allow it to be used in macroscopic systems such as polymer films or membranes.
Formula:C6H6N2O2Purity:Min. 95%Molecular weight:138.12 g/mol



