CymitQuimica logo

CAS 167826-88-2

:

(4R,5S,6S,7R)-1-benzyl-3-(1-cyclohexa-1,5-dienylmethyl)-4,7-bis(2-ethylbutyl)-5,6-dihydroxy-1,3-diazepan-2-one

Description:
The chemical substance with the name "(4R,5S,6S,7R)-1-benzyl-3-(1-cyclohexa-1,5-dienylmethyl)-4,7-bis(2-ethylbutyl)-5,6-dihydroxy-1,3-diazepan-2-one" and CAS number "167826-88-2" is a complex organic compound characterized by its unique structural features, including a diazepan ring, multiple hydroxyl groups, and a benzyl substituent. The presence of stereocenters in its structure indicates that it can exist in multiple stereoisomeric forms, which may influence its biological activity and chemical reactivity. The compound's functional groups, particularly the hydroxyl groups, suggest potential for hydrogen bonding, which can affect solubility and interaction with biological targets. Additionally, the presence of the cyclohexadiene moiety may contribute to its reactivity and potential applications in organic synthesis or medicinal chemistry. Overall, this compound's intricate structure and functional groups make it a subject of interest for further research in fields such as pharmacology and organic synthesis.
Formula:C31H48N2O3
InChI:InChI=1/C31H48N2O3/c1-5-23(6-2)19-27-29(34)30(35)28(20-24(7-3)8-4)33(22-26-17-13-10-14-18-26)31(36)32(27)21-25-15-11-9-12-16-25/h9,11-13,15-18,23-24,27-30,34-35H,5-8,10,14,19-22H2,1-4H3/t27-,28-,29+,30+/m1/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.