CAS 167889-18-1

N-[2-(1-Azabicyclo[3.3.0]octan-5-yl)ethyl]-2-nitroaniline fumarate

Description:

N-[2-(1-Azabicyclo[3.3.0]octan-5-yl)ethyl]-2-nitroaniline fumarate, with the CAS number 167889-18-1, is a chemical compound that features a bicyclic structure, which contributes to its unique properties. The presence of the azabicyclo structure indicates that it contains a nitrogen atom within a bicyclic framework, which can influence its biological activity and interaction with receptors. The compound also includes a nitroaniline moiety, suggesting potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The fumarate salt form indicates that it is a salt derived from fumaric acid, which can enhance its solubility and stability in various environments. This compound may exhibit specific pharmacological effects, making it of interest in research related to neuropharmacology or other therapeutic areas. Its structural complexity and functional groups suggest that it could participate in various chemical reactions, making it a candidate for further studies in drug development and synthesis.

Formula: C₁₉H₂₅N₃O₆

InChI: InChI=1/C15H21N3O2.C4H4O4/c19-18(20)14-6-2-1-5-13(14)16-10-9-15-7-3-11-17(15)12-4-8-15;5-3(6)1-2-4(7)8/h1-2,5-6,16H,3-4,7-12H2;1-2H,(H,5,6)(H,7,8)/b;2-1+

Synonyms:

• SK-946
• 2-nitro-N-[2-(tetrahydro-1H-pyrrolizin-7a(5H)-yl)ethyl]aniline (2E)-but-2-enedioate

SK 946

CAS: 167889-18-1

SK 946 is a cognition activator.

Formula: C₁₅H₂₁N₃O₂

Color and Shape: Solid

Molecular weight: 275.352

Ref: TM-T70283