
CAS 168009-91-4
:Achyranthoside D
Description:
Achyranthoside D is a chemical compound classified as a saponin, which is a type of glycoside known for its surface-active properties. It is derived from the plant Achyranthes bidentata, commonly used in traditional medicine. The compound is characterized by its complex structure, which typically includes a sugar moiety linked to a steroid or triterpenoid aglycone. Achyranthoside D has been studied for its potential pharmacological effects, including anti-inflammatory, antioxidant, and hepatoprotective activities. Its bioactivity is attributed to its ability to modulate various biological pathways, making it of interest in medicinal chemistry and natural product research. Additionally, saponins like Achyranthoside D can exhibit hemolytic activity, which is a characteristic feature of many compounds in this class. The compound's solubility and stability can vary depending on the pH and the presence of other substances, influencing its bioavailability and therapeutic potential. Overall, Achyranthoside D represents a significant area of study for its potential health benefits and applications in herbal medicine.
Formula:C53H82O25
InChI:InChI=1S/C53H82O25/c1-48(2)14-16-53(47(70)78-45-35(63)33(61)31(59)25(20-55)73-45)17-15-51(6)22(23(53)18-48)8-9-27-50(5)12-11-28(49(3,4)26(50)10-13-52(27,51)7)74-46-40(77-44-34(62)32(60)30(58)24(19-54)72-44)38(36(64)39(76-46)42(68)69)75-43(37(65)41(66)67)71-21-29(56)57/h8,23-28,30-40,43-46,54-55,58-65H,9-21H2,1-7H3,(H,56,57)(H,66,67)(H,68,69)
InChI key:InChIKey=VYVPIFXAYNIMKK-UHFFFAOYSA-N
SMILES:C(OC1OC(CO)C(O)C(O)C1O)(=O)C23C(C=4C(C)(CC2)C5(C)C(CC4)C6(C)C(CC5)C(C)(C)C(OC7C(OC8OC(CO)C(O)C(O)C8O)C(OC(OCC(O)=O)C(C(O)=O)O)C(O)C(C(O)=O)O7)CC6)CC(C)(C)CC3
Synonyms:- Achyranthoside D
- β-D-Glucopyranosiduronic acid, (3β)-28-(β-D-glucopyranosyloxy)-28-oxoolean-12-en-3-yl 3-O-[2-carboxy-1-(carboxymethoxy)-2-hydroxyethyl]-2-O-β-D-glucopyranosyl-
- (3β)-28-(β-D-Glucopyranosyloxy)-28-oxoolean-12-en-3-yl 3-O-[2-carboxy-1-(carboxymethoxy)-2-hydroxyethyl]-2-O-β-D-glucopyranosyl-β-D-glucopyranosiduronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Achyranthoside D
CAS:<p>Achyranthoside D is a glycoside compound, which is a type of product derived from the plant Achyranthes, commonly found in traditional Chinese medicine. The source of Achyranthoside D is from the root of the Achyranthes bidentata plant, which has been extensively studied for its various bioactive components. The mode of action of Achyranthoside D involves modulation of inflammatory pathways and enhancement of osteogenic activity, making it a promising candidate for research in bone-related disorders.</p>Formula:C53H82O25Purity:Min. 95%Molecular weight:1,119.2 g/mol

