CymitQuimica logo

CAS 16803-07-9

:

1,4-Dioxa-8-azaspiro[4.6]undecane

Description:
1,4-Dioxa-8-azaspiro[4.6]undecane, identified by its CAS number 16803-07-9, is a heterocyclic organic compound characterized by its unique spirocyclic structure, which incorporates both nitrogen and oxygen atoms within its ring system. This compound features a dioxane moiety, contributing to its stability and potential reactivity. The presence of the azaspiro configuration indicates that it contains a nitrogen atom integrated into a spiro compound, which can influence its chemical properties and biological activity. Typically, compounds of this nature may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The molecular structure suggests potential applications in drug development, particularly in designing agents that target specific biological pathways. Additionally, the compound's solubility, stability, and reactivity can vary based on environmental conditions, which are important factors to consider in both laboratory and industrial settings. Overall, 1,4-Dioxa-8-azaspiro[4.6]undecane represents a fascinating example of a complex organic molecule with potential utility in various chemical and pharmaceutical applications.
Formula:C8H15NO2
InChI:InChI=1S/C8H15NO2/c1-2-8(3-5-9-4-1)10-6-7-11-8/h9H,1-7H2
InChI key:FBZXTZIKSOUPGL-UHFFFAOYSA-N
SMILES:C1CC2(CCNC1)OCCO2
Found 2 products.