CAS 16807-37-7

2-Mercapto-5-methoxybenzoic acid

Description:

2-Mercapto-5-methoxybenzoic acid, with the CAS number 16807-37-7, is an organic compound characterized by the presence of both a thiol (-SH) group and a carboxylic acid (-COOH) group, which contribute to its reactivity and solubility properties. The methoxy group (-OCH3) enhances its hydrophobic character while also influencing its electronic properties. This compound typically appears as a solid at room temperature and is soluble in polar solvents due to the presence of the carboxylic acid group. Its thiol functionality makes it a potential candidate for various chemical reactions, including nucleophilic substitutions and redox reactions. Additionally, 2-Mercapto-5-methoxybenzoic acid may exhibit antioxidant properties, making it of interest in biochemical applications. The compound's structure allows for potential interactions with metal ions, which could be relevant in coordination chemistry. Overall, its unique combination of functional groups makes it a versatile compound in both synthetic and medicinal chemistry contexts.

Formula: C₈H₈O₃S

InChI: InChI=1/C8H8O3S/c1-11-5-2-3-7(12)6(4-5)8(9)10/h2-4,12H,1H3,(H,9,10)

SMILES: COc1ccc(c(c1)C(=O)O)S

Synonyms:

• 5-Methoxythiosalicylic Acid
• 6-Mercapto-m-anisic Acid
• Nsc 372684
• 5-Methoxy-2-Sulfanylbenzoic Acid

5-methoxy-2-sulfanylbenzoic acid

CAS: 16807-37-7

Formula: C₈H₈O₃S

Color and Shape: Solid

Molecular weight: 184.2123

Ref: IN-DA001XRT

2-Mercapto-5-methoxybenzoic Acid (90%)

Controlled Product

CAS: 16807-37-7

Applications A benzothiophene having antiallergic activity.
References Showalter, H.D., et al.: J. Med. Chem., 31, 1527 (1988), Sugiyama, H., et al.: Chem. Pharm. Bull., 55, 613 (2007),

Formula: C₈H₈O₃S

Purity: 90%

Color and Shape: Neat

Molecular weight: 184.21

Ref: TR-M253460