CAS 168102-06-5
:3,3-Difluoroproline
Description:
3,3-Difluoroproline is a fluorinated derivative of proline, an amino acid that plays a crucial role in protein structure and function. This compound features two fluorine atoms attached to the third carbon of the proline backbone, which significantly influences its chemical properties and biological activity. The presence of fluorine can enhance the stability and lipophilicity of the molecule, potentially affecting its interaction with biological targets. 3,3-Difluoroproline is often studied for its role in medicinal chemistry, particularly in the design of peptide-based drugs and as a building block in the synthesis of fluorinated compounds. Its unique structural characteristics may also impart distinctive conformational properties, making it a valuable tool in the study of protein folding and function. Additionally, the compound is of interest in the field of materials science and catalysis due to its potential applications in creating novel materials with specific functionalities. Overall, 3,3-Difluoroproline exemplifies the significance of fluorinated compounds in advancing both chemical research and pharmaceutical development.
Formula:C5H7F2NO2
InChI:InChI=1S/C5H7F2NO2/c6-5(7)1-2-8-3(5)4(9)10/h3,8H,1-2H2,(H,9,10)
InChI key:InChIKey=AKYUQSFIIOIBHO-UHFFFAOYSA-N
SMILES:C(O)(=O)C1C(F)(F)CCN1
Synonyms:- DL-Proline, 3,3-difluoro-
- 3,3-Difluoropyrrolidine-2-carboxylic acid
- 3,3-Difluoroproline
- Proline, 3,3-difluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
3,3-Difluoroproline
CAS:Controlled ProductFormula:C5H7F2NO2Color and Shape:NeatMolecular weight:151.111

