CAS 1681056-61-0: (αR)-α-[[(1,2-Dihydro-2-oxo-6-quinolinyl)sulfonyl]amino]-N-(2-furanylmethyl)-2-methoxy-N-(2-thienylmethyl)benzeneacetamide
Description:The chemical substance with the name "(αR)-α-[[(1,2-Dihydro-2-oxo-6-quinolinyl)sulfonyl]amino]-N-(2-furanylmethyl)-2-methoxy-N-(2-thienylmethyl)benzeneacetamide" and CAS number "1681056-61-0" is characterized by its complex molecular structure, which includes multiple functional groups such as sulfonamides, amides, and heterocycles. This compound features a quinoline moiety, which is known for its biological activity, particularly in medicinal chemistry. The presence of furan and thiophene rings suggests potential interactions with biological targets, making it of interest in drug development. The methoxy group may enhance lipophilicity, influencing the compound's pharmacokinetics. Additionally, the stereochemistry indicated by "(αR)" suggests that the compound has specific spatial arrangements that could affect its biological activity and interactions. Overall, this substance is likely to exhibit unique chemical properties and potential therapeutic applications, warranting further investigation in the context of pharmacology and medicinal chemistry.
Formula:C28H25N3O6S2
InChI:InChI=1S/C28H25N3O6S2/c1-36-25-9-3-2-8-23(25)27(28(33)31(17-20-6-4-14-37-20)18-21-7-5-15-38-21)30-39(34,35)22-11-12-24-19(16-22)10-13-26(32)29-24/h2-16,27,30H,17-18H2,1H3,(H,29,32)/t27-/m1/s1
InChI key:InChIKey=IYIGLWQQAMROOF-HHHXNRCGSA-N
SMILES:O=C1C=CC=2C=C(C=CC2N1)S(=O)(=O)NC(C(=O)N(CC=3OC=CC3)CC=4SC=CC4)C=5C=CC=CC5OC
- Synonyms:
- OSMI 1
- (αR)-α-[[(1,2-Dihydro-2-oxo-6-quinolinyl)sulfonyl]amino]-N-(2-furanylmethyl)-2-methoxy-N-(2-thienylmethyl)benzeneacetamide
- Benzeneacetamide, α-[[(1,2-dihydro-2-oxo-6-quinolinyl)sulfonyl]amino]-N-(2-furanylmethyl)-2-methoxy-N-(2-thienylmethyl)-, (αR)-