CAS 168127-34-2

2-[4-(2-amino-1,3-thiazol-4-yl)phenoxy]acetic acid

Description:

2-[4-(2-amino-1,3-thiazol-4-yl)phenoxy]acetic acid, with the CAS number 168127-34-2, is a chemical compound characterized by its unique structural features, which include a phenoxy group and a thiazole moiety. This compound typically exhibits properties associated with both acidic and basic functionalities due to the presence of the carboxylic acid group and the amino group in its structure. It is often studied for its potential biological activities, including antimicrobial and anti-inflammatory properties, owing to the thiazole ring, which is known for its pharmacological significance. The compound is likely to be soluble in polar solvents, reflecting the presence of the carboxylic acid, while its aromatic components may contribute to hydrophobic interactions. Additionally, the presence of the amino group can facilitate hydrogen bonding, influencing its reactivity and interaction with biological targets. Overall, this compound represents a class of bioactive molecules that may have applications in medicinal chemistry and drug development.

Formula: C₁₁H₁₀N₂O₃S

InChI: InChI=1/C11H10N2O3S/c12-11-13-9(6-17-11)7-1-3-8(4-2-7)16-5-10(14)15/h1-4,6H,5H2,(H2,12,13)(H,14,15)

SMILES: c1cc(ccc1c1csc(=N)[nH]1)OCC(=O)O

Synonyms:

• Acetic acid, (4-(2-amino-4-thiazolyl)phenoxy)-
• (4-(2-Amino-4-thiazolyl)phenoxy)acetic acid
• [4-(2-Amino-1,3-Thiazol-4-Yl)Phenoxy]Acetic Acid

Acetic acid, 2-[4-(2-amino-4-thiazolyl)phenoxy]-

CAS: 168127-34-2

Formula: C₁₁H₁₀N₂O₃S

Purity: 95%

Molecular weight: 250.2737

Ref: IN-DA001XTP

2-(4-(2-Aminothiazol-4-yl)phenoxy)acetic acid

CAS: 168127-34-2

Formula: C₁₁H₁₀N₂O₃S

Purity: >95%

Molecular weight: 250.27

Ref: 10-F447216