CAS 168194-08-9

4-(2-methylprop-2-en-1-yl)benzoic acid

Description:

4-(2-Methylprop-2-en-1-yl)benzoic acid, also known by its CAS number 168194-08-9, is an organic compound characterized by a benzoic acid structure with a substituent at the para position. The substituent is a 2-methylprop-2-en-1-yl group, which introduces a branched alkene moiety, contributing to its reactivity and potential applications in organic synthesis. This compound typically exhibits properties associated with both aromatic and aliphatic systems, including moderate solubility in organic solvents and potential for hydrogen bonding due to the carboxylic acid functional group. Its structure suggests it may participate in various chemical reactions, such as esterification or polymerization, making it of interest in materials science and organic chemistry. Additionally, the presence of the alkene group may allow for further functionalization, enhancing its utility in synthetic pathways. Overall, 4-(2-methylprop-2-en-1-yl)benzoic acid is a versatile compound with potential applications in pharmaceuticals, agrochemicals, and polymer chemistry.

Formula: C₁₁H₁₂O₂

InChI: InChI=1/C11H12O2/c1-8(2)7-9-3-5-10(6-4-9)11(12)13/h3-6H,1,7H2,2H3,(H,12,13)

SMILES: C=C(C)Cc1ccc(cc1)C(=O)O