CymitQuimica logo

CAS 1682-26-4

:

2,5-difluoro-3-(trifluoromethyl)aniline

Description:
2,5-Difluoro-3-(trifluoromethyl)aniline is an aromatic amine characterized by the presence of two fluorine atoms at the 2 and 5 positions and a trifluoromethyl group at the 3 position of the aniline ring. This compound is notable for its high degree of fluorination, which significantly influences its chemical properties, including increased lipophilicity and thermal stability. The presence of the trifluoromethyl group enhances its electron-withdrawing characteristics, affecting its reactivity and interactions in various chemical environments. As an aniline derivative, it can participate in nucleophilic substitution reactions and may serve as a precursor in the synthesis of more complex fluorinated compounds. Additionally, the fluorine substituents can impart unique properties, making it of interest in fields such as pharmaceuticals, agrochemicals, and materials science. Safety considerations are essential when handling this compound, as many fluorinated compounds can exhibit toxicity and environmental persistence.
Formula:C7H4F5N
InChI:InChI=1/C7H4F5N/c8-3-1-4(7(10,11)12)6(9)5(13)2-3/h1-2H,13H2
SMILES:c1c(cc(c(c1C(F)(F)F)F)N)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.