
CAS 168214-68-4
:2-[3-[3-[2-(7-Chloro-2-quinolinyl)ethenyl]phenyl]-2-propen-1-yl]-α,α-dimethylbenzenemethanol
Description:
The chemical substance known as 2-[3-[3-[2-(7-Chloro-2-quinolinyl)ethenyl]phenyl]-2-propen-1-yl]-α,α-dimethylbenzenemethanol, with the CAS number 168214-68-4, is a complex organic compound characterized by its intricate molecular structure. It features a quinoline moiety, which is known for its aromatic properties and potential biological activity. The presence of a chloro group enhances its reactivity and may influence its pharmacological profile. The compound also contains multiple aromatic rings and a hydroxyl group, which can contribute to its solubility and interaction with biological systems. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's synthesis and characterization would typically involve advanced organic chemistry techniques, and its properties, such as solubility, stability, and reactivity, would be of interest in both research and industrial contexts. Further studies would be necessary to fully elucidate its biological activity and potential therapeutic uses.
Formula:C29H26ClNO
InChI:InChI=1S/C29H26ClNO/c1-29(2,32)27-12-4-3-10-23(27)11-6-9-21-7-5-8-22(19-21)13-17-26-18-15-24-14-16-25(30)20-28(24)31-26/h3-10,12-20,32H,11H2,1-2H3
InChI key:InChIKey=DLLVZUPJFUZKDX-UHFFFAOYSA-N
SMILES:C(=CC1=CC(C=CCC2=C(C(C)(C)O)C=CC=C2)=CC=C1)C3=NC4=C(C=C3)C=CC(Cl)=C4
Synonyms:- 2-[3-[3-[2-(7-Chloro-2-quinolinyl)ethenyl]phenyl]-2-propen-1-yl]-α,α-dimethylbenzenemethanol
- Benzenemethanol, 2-[3-[3-[2-(7-chloro-2-quinolinyl)ethenyl]phenyl]-2-propenyl]-α,α-dimethyl-
- Benzenemethanol, 2-[3-[3-[2-(7-chloro-2-quinolinyl)ethenyl]phenyl]-2-propen-1-yl]-α,α-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
